C9H7ClF2O3S — CID 114790846
2-[(4-chlorophenyl)methylsulfinyl]-2,2-difluoroacetic acid (PubChem CID 114790846) has the molecular formula C9H7ClF2O3S and a molecular weight of 268.67 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfinyl]-2,2-difluoroacetic acid.
| Compound Name | 2-[(4-chlorophenyl)methylsulfinyl]-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 114790846 |
| Molecular Formula | C9H7ClF2O3S |
| Molecular Weight | 268.67 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfinyl]-2,2-difluoroacetic acid |
| SMILES | O=C(O)C(F)(F)S(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H7ClF2O3S/c10-7-3-1-6(2-4-7)5-16(15)9(11,12)8(13)14/h1-4H,5H2,(H,13,14) |
| InChIKey | SYPMECIPAIPNML-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.67 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |