About 2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid
2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid (PubChem CID 81217159) has the molecular formula C11H12F2O3S
and a molecular weight of 262.28 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid.
Analyze 2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid?
The IUPAC name of 2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid (CID 81217159) is 2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid.
What is the SMILES notation for 2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid?
The canonical SMILES for 2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid is Cc1cc(C)cc(CS(=O)C(F)(F)C(=O)O)c1.
What is the InChIKey of 2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid?
The InChIKey is KGZHYHCQURXMQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F2O3S/c1-7-3-8(2)5-9(4-7)6-17(16)11(12,13)10(14)15/h3-5H,6H2,1-2H3,(H,14,15).
What are the key properties of 2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid?
2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid has a molecular weight of 262.28 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dimethylphenyl)methylsulfinyl]-2,2-difluoroacetic acid is sourced from PubChem (CID 81217159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).