C15H15FOS — CID 63791578
1-[(2-fluorophenyl)sulfinylmethyl]-3,5-dimethylbenzene (PubChem CID 63791578) has the molecular formula C15H15FOS and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)sulfinylmethyl]-3,5-dimethylbenzene.
| Compound Name | 1-[(2-fluorophenyl)sulfinylmethyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 63791578 |
| Molecular Formula | C15H15FOS |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 1-[(2-fluorophenyl)sulfinylmethyl]-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(CS(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C15H15FOS/c1-11-7-12(2)9-13(8-11)10-18(17)15-6-4-3-5-14(15)16/h3-9H,10H2,1-2H3 |
| InChIKey | WLZMNRWSYCAMDK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |