C15H16FNOS — CID 81192692
4-[(3,4-dimethylphenyl)methylsulfinyl]-3-fluoroaniline (PubChem CID 81192692) has the molecular formula C15H16FNOS and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-[(3,4-dimethylphenyl)methylsulfinyl]-3-fluoroaniline.
| Compound Name | 4-[(3,4-dimethylphenyl)methylsulfinyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 81192692 |
| Molecular Formula | C15H16FNOS |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-[(3,4-dimethylphenyl)methylsulfinyl]-3-fluoroaniline |
| SMILES | Cc1ccc(CS(=O)c2ccc(N)cc2F)cc1C |
| InChI | InChI=1S/C15H16FNOS/c1-10-3-4-12(7-11(10)2)9-19(18)15-6-5-13(17)8-14(15)16/h3-8H,9,17H2,1-2H3 |
| InChIKey | KEYRGWAHPRLAHE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|