C16H15FO2S — CID 64637654
1-(3,4-dimethylphenyl)-2-(2-fluorophenyl)sulfinylethanone (PubChem CID 64637654) has the molecular formula C16H15FO2S and a molecular weight of 290.36 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-(2-fluorophenyl)sulfinylethanone.
| Compound Name | 1-(3,4-dimethylphenyl)-2-(2-fluorophenyl)sulfinylethanone |
|---|---|
| PubChem CID | 64637654 |
| Molecular Formula | C16H15FO2S |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-(2-fluorophenyl)sulfinylethanone |
| SMILES | Cc1ccc(C(=O)CS(=O)c2ccccc2F)cc1C |
| InChI | InChI=1S/C16H15FO2S/c1-11-7-8-13(9-12(11)2)15(18)10-20(19)16-6-4-3-5-14(16)17/h3-9H,10H2,1-2H3 |
| InChIKey | WNZHPBNVQGDCMB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |