C21H14Cl4O — CID 54259646
2,2,3-tris(4-chlorophenyl)propanoyl chloride (PubChem CID 54259646) has the molecular formula C21H14Cl4O and a molecular weight of 424.15 g/mol. Its IUPAC name is 2,2,3-tris(4-chlorophenyl)propanoyl chloride.
| Compound Name | 2,2,3-tris(4-chlorophenyl)propanoyl chloride |
|---|---|
| PubChem CID | 54259646 |
| Molecular Formula | C21H14Cl4O |
| Molecular Weight | 424.15 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | 2,2,3-tris(4-chlorophenyl)propanoyl chloride |
| SMILES | O=C(Cl)C(Cc1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14Cl4O/c22-17-7-1-14(2-8-17)13-21(20(25)26,15-3-9-18(23)10-4-15)16-5-11-19(24)12-6-16/h1-12H,13H2 |
| InChIKey | RCOWOBULSQNTCY-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.15 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|