C12H15Cl2NO — CID 140676450
2-chloro-4-(4-chlorophenyl)-3,3-dimethylbutanamide (PubChem CID 140676450) has the molecular formula C12H15Cl2NO and a molecular weight of 260.16 g/mol. Its IUPAC name is 2-chloro-4-(4-chlorophenyl)-3,3-dimethylbutanamide.
| Compound Name | 2-chloro-4-(4-chlorophenyl)-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 140676450 |
| Molecular Formula | C12H15Cl2NO |
| Molecular Weight | 260.16 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 2-chloro-4-(4-chlorophenyl)-3,3-dimethylbutanamide |
| SMILES | CC(C)(Cc1ccc(Cl)cc1)C(Cl)C(N)=O |
| InChI | InChI=1S/C12H15Cl2NO/c1-12(2,10(14)11(15)16)7-8-3-5-9(13)6-4-8/h3-6,10H,7H2,1-2H3,(H2,15,16) |
| InChIKey | IYFNXVVCMHZKFY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.16 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|