C15H21ClO3 — CID 114081535
methyl 4-(4-chlorophenyl)-3-hydroxy-3-methyl-2-propan-2-ylbutanoate (PubChem CID 114081535) has the molecular formula C15H21ClO3 and a molecular weight of 284.78 g/mol. Its IUPAC name is methyl 4-(4-chlorophenyl)-3-hydroxy-3-methyl-2-propan-2-ylbutanoate.
| Compound Name | methyl 4-(4-chlorophenyl)-3-hydroxy-3-methyl-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 114081535 |
| Molecular Formula | C15H21ClO3 |
| Molecular Weight | 284.78 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | methyl 4-(4-chlorophenyl)-3-hydroxy-3-methyl-2-propan-2-ylbutanoate |
| SMILES | COC(=O)C(C(C)C)C(C)(O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H21ClO3/c1-10(2)13(14(17)19-4)15(3,18)9-11-5-7-12(16)8-6-11/h5-8,10,13,18H,9H2,1-4H3 |
| InChIKey | RSYAHOOWFFWKJS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.78 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |