C13H19ClO — CID 60918368
1-(4-chlorophenyl)-2,3-dimethylpentan-2-ol (PubChem CID 60918368) has the molecular formula C13H19ClO and a molecular weight of 226.75 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,3-dimethylpentan-2-ol.
| Compound Name | 1-(4-chlorophenyl)-2,3-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 60918368 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-(4-chlorophenyl)-2,3-dimethylpentan-2-ol |
| SMILES | CCC(C)C(C)(O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H19ClO/c1-4-10(2)13(3,15)9-11-5-7-12(14)8-6-11/h5-8,10,15H,4,9H2,1-3H3 |
| InChIKey | HHBVDDOAEPRRNW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |