C15H23FO — CID 114284823
1-(4-fluorophenyl)-2,3,5-trimethylhexan-2-ol (PubChem CID 114284823) has the molecular formula C15H23FO and a molecular weight of 238.35 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2,3,5-trimethylhexan-2-ol.
| Compound Name | 1-(4-fluorophenyl)-2,3,5-trimethylhexan-2-ol |
|---|---|
| PubChem CID | 114284823 |
| Molecular Formula | C15H23FO |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-(4-fluorophenyl)-2,3,5-trimethylhexan-2-ol |
| SMILES | CC(C)CC(C)C(C)(O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H23FO/c1-11(2)9-12(3)15(4,17)10-13-5-7-14(16)8-6-13/h5-8,11-12,17H,9-10H2,1-4H3 |
| InChIKey | XWCVZSLLBACBRC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |