C14H21FO — CID 114832950
1-(4-fluorophenyl)-2,4-dimethylhexan-2-ol (PubChem CID 114832950) has the molecular formula C14H21FO and a molecular weight of 224.32 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2,4-dimethylhexan-2-ol.
| Compound Name | 1-(4-fluorophenyl)-2,4-dimethylhexan-2-ol |
|---|---|
| PubChem CID | 114832950 |
| Molecular Formula | C14H21FO |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 1-(4-fluorophenyl)-2,4-dimethylhexan-2-ol |
| SMILES | CCC(C)CC(C)(O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H21FO/c1-4-11(2)9-14(3,16)10-12-5-7-13(15)8-6-12/h5-8,11,16H,4,9-10H2,1-3H3 |
| InChIKey | FYUNFSMJKRGWHJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |