C15H19FO — CID 146003542
1-(4-fluorophenyl)-3,5-dimethylhept-1-yn-3-ol (PubChem CID 146003542) has the molecular formula C15H19FO and a molecular weight of 234.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3,5-dimethylhept-1-yn-3-ol.
| Compound Name | 1-(4-fluorophenyl)-3,5-dimethylhept-1-yn-3-ol |
|---|---|
| PubChem CID | 146003542 |
| Molecular Formula | C15H19FO |
| Molecular Weight | 234.31 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(4-fluorophenyl)-3,5-dimethylhept-1-yn-3-ol |
| SMILES | CCC(C)CC(C)(O)C#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FO/c1-4-12(2)11-15(3,17)10-9-13-5-7-14(16)8-6-13/h5-8,12,17H,4,11H2,1-3H3 |
| InChIKey | OGATVVRSGDWOEY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|