C32H28F2 — CID 143114534
1-[3,3-bis(4-fluorophenyl)prop-1-ynyl]-4-[4-[(2R)-2-methylbutyl]phenyl]benzene (PubChem CID 143114534) has the molecular formula C32H28F2 and a molecular weight of 450.57 g/mol. Its IUPAC name is 1-[3,3-bis(4-fluorophenyl)prop-1-ynyl]-4-[4-[(2R)-2-methylbutyl]phenyl]benzene.
| Compound Name | 1-[3,3-bis(4-fluorophenyl)prop-1-ynyl]-4-[4-[(2R)-2-methylbutyl]phenyl]benzene |
|---|---|
| PubChem CID | 143114534 |
| Molecular Formula | C32H28F2 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 1-[3,3-bis(4-fluorophenyl)prop-1-ynyl]-4-[4-[(2R)-2-methylbutyl]phenyl]benzene |
| SMILES | CC[C@@H](C)Cc1ccc(-c2ccc(C#CC(c3ccc(F)cc3)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H28F2/c1-3-23(2)22-25-6-11-27(12-7-25)26-9-4-24(5-10-26)8-21-32(28-13-17-30(33)18-14-28)29-15-19-31(34)20-16-29/h4-7,9-20,23,32H,3,22H2,1-2H3/t23-/m1/s1 |
| InChIKey | ZIVWWYHHTFOJBZ-HSZRJFAPSA-N |
| XLogP | 8.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|