C25H21FN2S — CID 171432913
3-fluoro-5-isothiocyanato-2-[2-[4-[4-(2-methylbutyl)phenyl]phenyl]ethynyl]pyridine (PubChem CID 171432913) has the molecular formula C25H21FN2S and a molecular weight of 400.52 g/mol. Its IUPAC name is 3-fluoro-5-isothiocyanato-2-[2-[4-[4-(2-methylbutyl)phenyl]phenyl]ethynyl]pyridine.
| Compound Name | 3-fluoro-5-isothiocyanato-2-[2-[4-[4-(2-methylbutyl)phenyl]phenyl]ethynyl]pyridine |
|---|---|
| PubChem CID | 171432913 |
| Molecular Formula | C25H21FN2S |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 3-fluoro-5-isothiocyanato-2-[2-[4-[4-(2-methylbutyl)phenyl]phenyl]ethynyl]pyridine |
| SMILES | CCC(C)Cc1ccc(-c2ccc(C#Cc3ncc(N=C=S)cc3F)cc2)cc1 |
| InChI | InChI=1S/C25H21FN2S/c1-3-18(2)14-20-6-11-22(12-7-20)21-9-4-19(5-10-21)8-13-25-24(26)15-23(16-27-25)28-17-29/h4-7,9-12,15-16,18H,3,14H2,1-2H3 |
| InChIKey | UUHMFIDGALBSKE-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|