About 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene
2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene (PubChem CID 178054379) has the molecular formula C24H19F2NS2
and a molecular weight of 423.55 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene.
Molecular Properties
| Compound Name | 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene |
| PubChem CID | 178054379 |
| Molecular Formula | C24H19F2NS2 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene |
| SMILES | CCC(C)Cc1ccc(-c2cc(F)c(C#Cc3ccc(N=C=S)cc3)c(F)c2)s1 |
| InChI | InChI=1S/C24H19F2NS2/c1-3-16(2)12-20-9-11-24(29-20)18-13-22(25)21(23(26)14-18)10-6-17-4-7-19(8-5-17)27-15-28/h4-5,7-9,11,13-14,16H,3,12H2,1-2H3 |
| InChIKey | JCHQGFYPFQXJPK-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene?
The IUPAC name of 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene (CID 178054379) is 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene.
What is the SMILES notation for 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene?
The canonical SMILES for 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene is CCC(C)Cc1ccc(-c2cc(F)c(C#Cc3ccc(N=C=S)cc3)c(F)c2)s1.
What is the InChIKey of 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene?
The InChIKey is JCHQGFYPFQXJPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F2NS2/c1-3-16(2)12-20-9-11-24(29-20)18-13-22(25)21(23(26)14-18)10-6-17-4-7-19(8-5-17)27-15-28/h4-5,7-9,11,13-14,16H,3,12H2,1-2H3.
What are the key properties of 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene?
2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene has a molecular weight of 423.55 g/mol, XLogP of 7.42, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-difluoro-4-[2-(4-isothiocyanatophenyl)ethynyl]phenyl]-5-(2-methylbutyl)thiophene is sourced from PubChem (CID 178054379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).