C24H13F2NS — CID 168948683
1,3-difluoro-5-(2-isothiocyanatoethynyl)-2-[2-[4-(4-methylphenyl)phenyl]ethynyl]benzene (PubChem CID 168948683) has the molecular formula C24H13F2NS and a molecular weight of 385.44 g/mol. Its IUPAC name is 1,3-difluoro-5-(2-isothiocyanatoethynyl)-2-[2-[4-(4-methylphenyl)phenyl]ethynyl]benzene.
| Compound Name | 1,3-difluoro-5-(2-isothiocyanatoethynyl)-2-[2-[4-(4-methylphenyl)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 168948683 |
| Molecular Formula | C24H13F2NS |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 1,3-difluoro-5-(2-isothiocyanatoethynyl)-2-[2-[4-(4-methylphenyl)phenyl]ethynyl]benzene |
| SMILES | Cc1ccc(-c2ccc(C#Cc3c(F)cc(C#CN=C=S)cc3F)cc2)cc1 |
| InChI | InChI=1S/C24H13F2NS/c1-17-2-7-20(8-3-17)21-9-4-18(5-10-21)6-11-22-23(25)14-19(15-24(22)26)12-13-27-16-28/h2-5,7-10,14-15H,1H3 |
| InChIKey | APJMQQQMFKLVMW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|