C26H20BF2 — CID 21360055
CID 21360055 (PubChem CID 21360055) has the molecular formula C26H20BF2 and a molecular weight of 381.25 g/mol.
| Compound Name | CID 21360055 |
|---|---|
| PubChem CID | 21360055 |
| Molecular Formula | C26H20BF2 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | — |
| SMILES | C[B]c1cc(C)c(C#Cc2cc(F)c(C#Cc3ccc(C)cc3)c(F)c2)cc1C |
| InChI | InChI=1S/C26H20BF2/c1-17-5-7-20(8-6-17)10-12-23-25(28)15-21(16-26(23)29)9-11-22-13-19(3)24(27-4)14-18(22)2/h5-8,13-16H,1-4H3 |
| InChIKey | HKCLFYNUUYZGOR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|