About CID 21360055
CID 21360055 (PubChem CID 21360055) has the molecular formula C26H20BF2
and a molecular weight of 381.25 g/mol.
Molecular Properties
| Compound Name | CID 21360055 |
| PubChem CID | 21360055 |
| Molecular Formula | C26H20BF2 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | — |
| SMILES | C[B]c1cc(C)c(C#Cc2cc(F)c(C#Cc3ccc(C)cc3)c(F)c2)cc1C |
| InChI | InChI=1S/C26H20BF2/c1-17-5-7-20(8-6-17)10-12-23-25(28)15-21(16-26(23)29)9-11-22-13-19(3)24(27-4)14-18(22)2/h5-8,13-16H,1-4H3 |
| InChIKey | HKCLFYNUUYZGOR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 21360055 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 21360055?
The IUPAC name of CID 21360055 (CID 21360055) is not available.
What is the SMILES notation for CID 21360055?
The canonical SMILES for CID 21360055 is C[B]c1cc(C)c(C#Cc2cc(F)c(C#Cc3ccc(C)cc3)c(F)c2)cc1C.
What is the InChIKey of CID 21360055?
The InChIKey is HKCLFYNUUYZGOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20BF2/c1-17-5-7-20(8-6-17)10-12-23-25(28)15-21(16-26(23)29)9-11-22-13-19(3)24(27-4)14-18(22)2/h5-8,13-16H,1-4H3.
What are the key properties of CID 21360055?
CID 21360055 has a molecular weight of 381.25 g/mol, XLogP of 5.07, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 21360055 is sourced from PubChem (CID 21360055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).