C25H18BF2 — CID 21359958
CID 21359958 (PubChem CID 21359958) has the molecular formula C25H18BF2 and a molecular weight of 367.23 g/mol.
| Compound Name | CID 21359958 |
|---|---|
| PubChem CID | 21359958 |
| Molecular Formula | C25H18BF2 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | — |
| SMILES | C[B]c1c(F)cc(C#Cc2ccc(C#Cc3ccc(C)cc3)c(C)c2)cc1F |
| InChI | InChI=1S/C25H18BF2/c1-17-4-6-19(7-5-17)10-12-22-13-11-20(14-18(22)2)8-9-21-15-23(27)25(26-3)24(28)16-21/h4-7,11,13-16H,1-3H3 |
| InChIKey | HUKOJNQUJAQZEW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|