C18H13F — CID 54001009
1-ethynyl-4-[2-(2-fluoro-4-methylphenyl)ethynyl]-2-methylbenzene (PubChem CID 54001009) has the molecular formula C18H13F and a molecular weight of 248.30 g/mol. Its IUPAC name is 1-ethynyl-4-[2-(2-fluoro-4-methylphenyl)ethynyl]-2-methylbenzene.
| Compound Name | 1-ethynyl-4-[2-(2-fluoro-4-methylphenyl)ethynyl]-2-methylbenzene |
|---|---|
| PubChem CID | 54001009 |
| Molecular Formula | C18H13F |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-ethynyl-4-[2-(2-fluoro-4-methylphenyl)ethynyl]-2-methylbenzene |
| SMILES | C#Cc1ccc(C#Cc2ccc(C)cc2F)cc1C |
| InChI | InChI=1S/C18H13F/c1-4-16-9-6-15(12-14(16)3)7-10-17-8-5-13(2)11-18(17)19/h1,5-6,8-9,11-12H,2-3H3 |
| InChIKey | KLPNXMBWQVWVKD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|