C25H19BF — CID 21359979
CID 21359979 (PubChem CID 21359979) has the molecular formula C25H19BF and a molecular weight of 349.24 g/mol.
| Compound Name | CID 21359979 |
|---|---|
| PubChem CID | 21359979 |
| Molecular Formula | C25H19BF |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | — |
| SMILES | C[B]c1ccc(C#Cc2ccc(C#Cc3ccc(C)cc3)c(C)c2)cc1F |
| InChI | InChI=1S/C25H19BF/c1-18-4-6-20(7-5-18)10-13-23-14-11-21(16-19(23)2)8-9-22-12-15-24(26-3)25(27)17-22/h4-7,11-12,14-17H,1-3H3 |
| InChIKey | LIFSPTNYDUMIHH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|