C27H22F2 — CID 21359852
2-(2,2-difluoropropyl)-1,4-bis[2-(4-methylphenyl)ethynyl]benzene (PubChem CID 21359852) has the molecular formula C27H22F2 and a molecular weight of 384.47 g/mol. Its IUPAC name is 2-(2,2-difluoropropyl)-1,4-bis[2-(4-methylphenyl)ethynyl]benzene.
| Compound Name | 2-(2,2-difluoropropyl)-1,4-bis[2-(4-methylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 21359852 |
| Molecular Formula | C27H22F2 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-(2,2-difluoropropyl)-1,4-bis[2-(4-methylphenyl)ethynyl]benzene |
| SMILES | Cc1ccc(C#Cc2ccc(C#Cc3ccc(C)cc3)c(CC(C)(F)F)c2)cc1 |
| InChI | InChI=1S/C27H22F2/c1-20-4-8-22(9-5-20)12-13-24-15-17-25(26(18-24)19-27(3,28)29)16-14-23-10-6-21(2)7-11-23/h4-11,15,17-18H,19H2,1-3H3 |
| InChIKey | LOQSDRSTXWOJJC-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|