C17H16O — CID 145059476
3-ethyl-4-[2-(4-methylphenyl)ethynyl]phenol (PubChem CID 145059476) has the molecular formula C17H16O and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-ethyl-4-[2-(4-methylphenyl)ethynyl]phenol.
| Compound Name | 3-ethyl-4-[2-(4-methylphenyl)ethynyl]phenol |
|---|---|
| PubChem CID | 145059476 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 3-ethyl-4-[2-(4-methylphenyl)ethynyl]phenol |
| SMILES | CCc1cc(O)ccc1C#Cc1ccc(C)cc1 |
| InChI | InChI=1S/C17H16O/c1-3-15-12-17(18)11-10-16(15)9-8-14-6-4-13(2)5-7-14/h4-7,10-12,18H,3H2,1-2H3 |
| InChIKey | WWOBBSVFTJWYED-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|