C23H15F2NOS — CID 165392345
4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol (PubChem CID 165392345) has the molecular formula C23H15F2NOS and a molecular weight of 391.44 g/mol. Its IUPAC name is 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol.
| Compound Name | 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol |
|---|---|
| PubChem CID | 165392345 |
| Molecular Formula | C23H15F2NOS |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol |
| SMILES | CCc1cc(O)ccc1C#Cc1ccc(-c2cc(F)c(N=C=S)c(F)c2)cc1 |
| InChI | InChI=1S/C23H15F2NOS/c1-2-16-11-20(27)10-9-17(16)6-3-15-4-7-18(8-5-15)19-12-21(24)23(26-14-28)22(25)13-19/h4-5,7-13,27H,2H2,1H3 |
| InChIKey | FEPLMBBLCIIAMJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|