About 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol
4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol (PubChem CID 165392345) has the molecular formula C23H15F2NOS
and a molecular weight of 391.44 g/mol. Its IUPAC name is 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol.
Molecular Properties
| Compound Name | 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol |
| PubChem CID | 165392345 |
| Molecular Formula | C23H15F2NOS |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol |
| SMILES | CCc1cc(O)ccc1C#Cc1ccc(-c2cc(F)c(N=C=S)c(F)c2)cc1 |
| InChI | InChI=1S/C23H15F2NOS/c1-2-16-11-20(27)10-9-17(16)6-3-15-4-7-18(8-5-15)19-12-21(24)23(26-14-28)22(25)13-19/h4-5,7-13,27H,2H2,1H3 |
| InChIKey | FEPLMBBLCIIAMJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol?
The IUPAC name of 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol (CID 165392345) is 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol.
What is the SMILES notation for 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol?
The canonical SMILES for 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol is CCc1cc(O)ccc1C#Cc1ccc(-c2cc(F)c(N=C=S)c(F)c2)cc1.
What is the InChIKey of 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol?
The InChIKey is FEPLMBBLCIIAMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F2NOS/c1-2-16-11-20(27)10-9-17(16)6-3-15-4-7-18(8-5-15)19-12-21(24)23(26-14-28)22(25)13-19/h4-5,7-13,27H,2H2,1H3.
What are the key properties of 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol?
4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol has a molecular weight of 391.44 g/mol, XLogP of 6.03, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-(3,5-difluoro-4-isothiocyanatophenyl)phenyl]ethynyl]-3-ethylphenol is sourced from PubChem (CID 165392345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).