C21H15F2NOS — CID 163880943
1,3-difluoro-2-isothiocyanato-5-[4-[(4-methylphenyl)methoxy]phenyl]benzene (PubChem CID 163880943) has the molecular formula C21H15F2NOS and a molecular weight of 367.42 g/mol. Its IUPAC name is 1,3-difluoro-2-isothiocyanato-5-[4-[(4-methylphenyl)methoxy]phenyl]benzene.
| Compound Name | 1,3-difluoro-2-isothiocyanato-5-[4-[(4-methylphenyl)methoxy]phenyl]benzene |
|---|---|
| PubChem CID | 163880943 |
| Molecular Formula | C21H15F2NOS |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 1,3-difluoro-2-isothiocyanato-5-[4-[(4-methylphenyl)methoxy]phenyl]benzene |
| SMILES | Cc1ccc(COc2ccc(-c3cc(F)c(N=C=S)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C21H15F2NOS/c1-14-2-4-15(5-3-14)12-25-18-8-6-16(7-9-18)17-10-19(22)21(24-13-26)20(23)11-17/h2-11H,12H2,1H3 |
| InChIKey | PTDGLOJPBRNSQA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|