C23H16FNS — CID 129308601
4-(4-ethylphenyl)-2-fluoro-1-[2-(4-isothiocyanatophenyl)ethynyl]benzene (PubChem CID 129308601) has the molecular formula C23H16FNS and a molecular weight of 357.45 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-2-fluoro-1-[2-(4-isothiocyanatophenyl)ethynyl]benzene.
| Compound Name | 4-(4-ethylphenyl)-2-fluoro-1-[2-(4-isothiocyanatophenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 129308601 |
| Molecular Formula | C23H16FNS |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 4-(4-ethylphenyl)-2-fluoro-1-[2-(4-isothiocyanatophenyl)ethynyl]benzene |
| SMILES | CCc1ccc(-c2ccc(C#Cc3ccc(N=C=S)cc3)c(F)c2)cc1 |
| InChI | InChI=1S/C23H16FNS/c1-2-17-3-8-19(9-4-17)21-12-11-20(23(24)15-21)10-5-18-6-13-22(14-7-18)25-16-26/h3-4,6-9,11-15H,2H2,1H3 |
| InChIKey | WDGDXHNYFRCOPW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|