C38H35NS — CID 101366720
2-ethyl-1-[2-(3-ethyl-4-isothiocyanatophenyl)ethynyl]-4-[2-[4-(4-pentylphenyl)phenyl]ethynyl]benzene (PubChem CID 101366720) has the molecular formula C38H35NS and a molecular weight of 537.77 g/mol. Its IUPAC name is 2-ethyl-1-[2-(3-ethyl-4-isothiocyanatophenyl)ethynyl]-4-[2-[4-(4-pentylphenyl)phenyl]ethynyl]benzene.
| Compound Name | 2-ethyl-1-[2-(3-ethyl-4-isothiocyanatophenyl)ethynyl]-4-[2-[4-(4-pentylphenyl)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 101366720 |
| Molecular Formula | C38H35NS |
| Molecular Weight | 537.77 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 2-ethyl-1-[2-(3-ethyl-4-isothiocyanatophenyl)ethynyl]-4-[2-[4-(4-pentylphenyl)phenyl]ethynyl]benzene |
| SMILES | CCCCCc1ccc(-c2ccc(C#Cc3ccc(C#Cc4ccc(N=C=S)c(CC)c4)c(CC)c3)cc2)cc1 |
| InChI | InChI=1S/C38H35NS/c1-4-7-8-9-29-12-19-36(20-13-29)37-21-14-30(15-22-37)10-11-31-16-23-35(33(5-2)26-31)24-17-32-18-25-38(39-28-40)34(6-3)27-32/h12-16,18-23,25-27H,4-9H2,1-3H3 |
| InChIKey | VUEXUSAGRMESCR-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.77 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|