C25H18F3NS — CID 170532827
1-(4-butylphenyl)-2,3-difluoro-4-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]benzene (PubChem CID 170532827) has the molecular formula C25H18F3NS and a molecular weight of 421.49 g/mol. Its IUPAC name is 1-(4-butylphenyl)-2,3-difluoro-4-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]benzene.
| Compound Name | 1-(4-butylphenyl)-2,3-difluoro-4-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 170532827 |
| Molecular Formula | C25H18F3NS |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 1-(4-butylphenyl)-2,3-difluoro-4-[2-(3-fluoro-4-isothiocyanatophenyl)ethynyl]benzene |
| SMILES | CCCCc1ccc(-c2ccc(C#Cc3ccc(N=C=S)c(F)c3)c(F)c2F)cc1 |
| InChI | InChI=1S/C25H18F3NS/c1-2-3-4-17-5-9-19(10-6-17)21-13-12-20(24(27)25(21)28)11-7-18-8-14-23(29-16-30)22(26)15-18/h5-6,8-10,12-15H,2-4H2,1H3 |
| InChIKey | IYYXATUHSGMKOZ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|