C18H13F2NS — CID 165392340
1,4-difluoro-2-isothiocyanato-5-[2-(4-propylphenyl)ethynyl]benzene (PubChem CID 165392340) has the molecular formula C18H13F2NS and a molecular weight of 313.37 g/mol. Its IUPAC name is 1,4-difluoro-2-isothiocyanato-5-[2-(4-propylphenyl)ethynyl]benzene.
| Compound Name | 1,4-difluoro-2-isothiocyanato-5-[2-(4-propylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 165392340 |
| Molecular Formula | C18H13F2NS |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 1,4-difluoro-2-isothiocyanato-5-[2-(4-propylphenyl)ethynyl]benzene |
| SMILES | CCCc1ccc(C#Cc2cc(F)c(N=C=S)cc2F)cc1 |
| InChI | InChI=1S/C18H13F2NS/c1-2-3-13-4-6-14(7-5-13)8-9-15-10-17(20)18(21-12-22)11-16(15)19/h4-7,10-11H,2-3H2,1H3 |
| InChIKey | QZNVRBLHALPGHB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|