C24H23F2NS — CID 165392310
1,4-difluoro-2-isothiocyanato-5-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]benzene (PubChem CID 165392310) has the molecular formula C24H23F2NS and a molecular weight of 395.52 g/mol. Its IUPAC name is 1,4-difluoro-2-isothiocyanato-5-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]benzene.
| Compound Name | 1,4-difluoro-2-isothiocyanato-5-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 165392310 |
| Molecular Formula | C24H23F2NS |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 1,4-difluoro-2-isothiocyanato-5-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]benzene |
| SMILES | CCCC1CCC(c2ccc(C#Cc3cc(F)c(N=C=S)cc3F)cc2)CC1 |
| InChI | InChI=1S/C24H23F2NS/c1-2-3-17-4-9-19(10-5-17)20-11-6-18(7-12-20)8-13-21-14-23(26)24(27-16-28)15-22(21)25/h6-7,11-12,14-15,17,19H,2-5,9-10H2,1H3 |
| InChIKey | NCMONIAWLDUMQV-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|