C25H26FNS — CID 163272795
1-fluoro-2-isothiocyanato-3-methyl-5-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]benzene (PubChem CID 163272795) has the molecular formula C25H26FNS and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-fluoro-2-isothiocyanato-3-methyl-5-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]benzene.
| Compound Name | 1-fluoro-2-isothiocyanato-3-methyl-5-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 163272795 |
| Molecular Formula | C25H26FNS |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-fluoro-2-isothiocyanato-3-methyl-5-[2-[4-(4-propylcyclohexyl)phenyl]ethynyl]benzene |
| SMILES | CCCC1CCC(c2ccc(C#Cc3cc(C)c(N=C=S)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C25H26FNS/c1-3-4-19-7-11-22(12-8-19)23-13-9-20(10-14-23)5-6-21-15-18(2)25(27-17-28)24(26)16-21/h9-10,13-16,19,22H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | BCRONQRIXVGCLH-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|