C31H25F2NS — CID 169279781
6-[2-[4-[2-(3,5-difluoro-4-isothiocyanatophenyl)ethynyl]-3-methylphenyl]ethynyl]-2-propyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 169279781) has the molecular formula C31H25F2NS and a molecular weight of 481.61 g/mol. Its IUPAC name is 6-[2-[4-[2-(3,5-difluoro-4-isothiocyanatophenyl)ethynyl]-3-methylphenyl]ethynyl]-2-propyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[2-[4-[2-(3,5-difluoro-4-isothiocyanatophenyl)ethynyl]-3-methylphenyl]ethynyl]-2-propyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 169279781 |
| Molecular Formula | C31H25F2NS |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 6-[2-[4-[2-(3,5-difluoro-4-isothiocyanatophenyl)ethynyl]-3-methylphenyl]ethynyl]-2-propyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCC1CCc2cc(C#Cc3ccc(C#Cc4cc(F)c(N=C=S)c(F)c4)c(C)c3)ccc2C1 |
| InChI | InChI=1S/C31H25F2NS/c1-3-4-22-8-13-28-17-24(9-14-27(28)16-22)6-5-23-7-11-26(21(2)15-23)12-10-25-18-29(32)31(34-20-35)30(33)19-25/h7,9,11,14-15,17-19,22H,3-4,8,13,16H2,1-2H3 |
| InChIKey | OUCLNGWKXSDATI-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|