C21H19ClF2 — CID 58840135
6-[2-(4-chloro-3-fluorophenyl)ethynyl]-5-fluoro-2-propyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 58840135) has the molecular formula C21H19ClF2 and a molecular weight of 344.83 g/mol. Its IUPAC name is 6-[2-(4-chloro-3-fluorophenyl)ethynyl]-5-fluoro-2-propyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[2-(4-chloro-3-fluorophenyl)ethynyl]-5-fluoro-2-propyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 58840135 |
| Molecular Formula | C21H19ClF2 |
| Molecular Weight | 344.83 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 6-[2-(4-chloro-3-fluorophenyl)ethynyl]-5-fluoro-2-propyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCC1CCc2c(ccc(C#Cc3ccc(Cl)c(F)c3)c2F)C1 |
| InChI | InChI=1S/C21H19ClF2/c1-2-3-14-5-10-18-17(12-14)9-8-16(21(18)24)7-4-15-6-11-19(22)20(23)13-15/h6,8-9,11,13-14H,2-3,5,10,12H2,1H3 |
| InChIKey | WRGKKEVUXACBFG-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.83 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|