C23H19F5O — CID 58840028
2-but-3-enyl-6-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-5-fluoro-1,2,3,4-tetrahydronaphthalene (PubChem CID 58840028) has the molecular formula C23H19F5O and a molecular weight of 406.39 g/mol. Its IUPAC name is 2-but-3-enyl-6-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-5-fluoro-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-but-3-enyl-6-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-5-fluoro-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 58840028 |
| Molecular Formula | C23H19F5O |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-but-3-enyl-6-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-5-fluoro-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=CCCC1CCc2c(ccc(C#Cc3cc(F)c(OC(F)F)c(F)c3)c2F)C1 |
| InChI | InChI=1S/C23H19F5O/c1-2-3-4-14-6-10-18-17(11-14)9-8-16(21(18)26)7-5-15-12-19(24)22(20(25)13-15)29-23(27)28/h2,8-9,12-14,23H,1,3-4,6,10-11H2 |
| InChIKey | UKXAMPXIMDUYKQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|