C22H17F5O — CID 58840082
6-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-5-fluoro-2-[(E)-prop-1-enyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 58840082) has the molecular formula C22H17F5O and a molecular weight of 392.37 g/mol. Its IUPAC name is 6-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-5-fluoro-2-[(E)-prop-1-enyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-5-fluoro-2-[(E)-prop-1-enyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 58840082 |
| Molecular Formula | C22H17F5O |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 6-[2-[4-(difluoromethoxy)-3,5-difluorophenyl]ethynyl]-5-fluoro-2-[(E)-prop-1-enyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/C1CCc2c(ccc(C#Cc3cc(F)c(OC(F)F)c(F)c3)c2F)C1 |
| InChI | InChI=1S/C22H17F5O/c1-2-3-13-5-9-17-16(10-13)8-7-15(20(17)25)6-4-14-11-18(23)21(19(24)12-14)28-22(26)27/h2-3,7-8,11-13,22H,5,9-10H2,1H3/b3-2+ |
| InChIKey | FXZOQELJGXZKSC-NSCUHMNNSA-N |
| XLogP | 5.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|