C27H27F3 — CID 139853568
2-[4-[(E)-prop-1-enyl]cyclohexyl]-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139853568) has the molecular formula C27H27F3 and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-[4-[(E)-prop-1-enyl]cyclohexyl]-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[4-[(E)-prop-1-enyl]cyclohexyl]-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139853568 |
| Molecular Formula | C27H27F3 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 2-[4-[(E)-prop-1-enyl]cyclohexyl]-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/C1CCC(C2CCc3cc(C#Cc4cc(F)c(F)c(F)c4)ccc3C2)CC1 |
| InChI | InChI=1S/C27H27F3/c1-2-3-18-6-9-21(10-7-18)23-13-12-22-14-19(8-11-24(22)17-23)4-5-20-15-25(28)27(30)26(29)16-20/h2-3,8,11,14-16,18,21,23H,6-7,9-10,12-13,17H2,1H3/b3-2+ |
| InChIKey | VSAZSQAANXAISI-NSCUHMNNSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|