C26H36 — CID 22383907
6-[(E)-prop-1-enyl]-2-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 22383907) has the molecular formula C26H36 and a molecular weight of 348.57 g/mol. Its IUPAC name is 6-[(E)-prop-1-enyl]-2-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[(E)-prop-1-enyl]-2-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 22383907 |
| Molecular Formula | C26H36 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | 6-[(E)-prop-1-enyl]-2-[6-[(E)-prop-1-enyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/c1ccc2c(c1)CCC(C1CCC3CC(/C=C/C)CCC3C1)C2 |
| InChI | InChI=1S/C26H36/c1-3-5-19-7-9-23-17-25(13-11-21(23)15-19)26-14-12-22-16-20(6-4-2)8-10-24(22)18-26/h3-7,9,15,20,22,24-26H,8,10-14,16-18H2,1-2H3/b5-3+,6-4+ |
| InChIKey | DTUJZWXQEAPZBU-GGWOSOGESA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|