C30H46 — CID 90685714
2-[(4aR,6R,8aR)-6-prop-1-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-heptyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 90685714) has the molecular formula C30H46 and a molecular weight of 406.70 g/mol. Its IUPAC name is 2-[(4aR,6R,8aR)-6-prop-1-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-heptyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[(4aR,6R,8aR)-6-prop-1-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-heptyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 90685714 |
| Molecular Formula | C30H46 |
| Molecular Weight | 406.70 g/mol |
| Exact Mass | 406.36 |
| IUPAC Name | 2-[(4aR,6R,8aR)-6-prop-1-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-heptyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC=C[C@@H]1CC[C@@H]2CC(C3CCc4cc(CCCCCCC)ccc4C3)CC[C@@H]2C1 |
| InChI | InChI=1S/C30H46/c1-3-5-6-7-8-10-24-12-14-28-22-30(18-16-26(28)20-24)29-17-15-25-19-23(9-4-2)11-13-27(25)21-29/h4,9,12,14,20,23,25,27,29-30H,3,5-8,10-11,13,15-19,21-22H2,1-2H3/t23-,25-,27-,29?,30?/m1/s1 |
| InChIKey | LEXQKYNPADRHKR-OTFXISIJSA-N |
| XLogP | 8.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.70 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|