C30H46O — CID 91463899
2-[(6R,8aR)-6-but-2-enoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-hexyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 91463899) has the molecular formula C30H46O and a molecular weight of 422.70 g/mol. Its IUPAC name is 2-[(6R,8aR)-6-but-2-enoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-hexyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[(6R,8aR)-6-but-2-enoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-hexyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 91463899 |
| Molecular Formula | C30H46O |
| Molecular Weight | 422.70 g/mol |
| Exact Mass | 422.35 |
| IUPAC Name | 2-[(6R,8aR)-6-but-2-enoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-hexyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC=CCO[C@@H]1CC[C@@H]2CC(C3CCc4cc(CCCCCC)ccc4C3)CCC2C1 |
| InChI | InChI=1S/C30H46O/c1-3-5-7-8-9-23-10-11-25-20-26(13-12-24(25)19-23)27-14-15-29-22-30(31-18-6-4-2)17-16-28(29)21-27/h4,6,10-11,19,26-30H,3,5,7-9,12-18,20-22H2,1-2H3/t26?,27?,28-,29?,30-/m1/s1 |
| InChIKey | PIWAOTFIBLRFGB-LACQISRUSA-N |
| XLogP | 8.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.70 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|