C28H42O2 — CID 20808500
2-[(6R,8aR)-6-[(E)-but-2-enoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-butoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 20808500) has the molecular formula C28H42O2 and a molecular weight of 410.64 g/mol. Its IUPAC name is 2-[(6R,8aR)-6-[(E)-but-2-enoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-butoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[(6R,8aR)-6-[(E)-but-2-enoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-butoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 20808500 |
| Molecular Formula | C28H42O2 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.32 |
| IUPAC Name | 2-[(6R,8aR)-6-[(E)-but-2-enoxy]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-butoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/CO[C@@H]1CC[C@@H]2CC(C3CCc4cc(OCCCC)ccc4C3)CCC2C1 |
| InChI | InChI=1S/C28H42O2/c1-3-5-15-29-27-13-11-23-17-21(7-9-25(23)19-27)22-8-10-26-20-28(30-16-6-4-2)14-12-24(26)18-22/h3,5,12,14,20-23,25,27H,4,6-11,13,15-19H2,1-2H3/b5-3+/t21?,22?,23-,25?,27-/m1/s1 |
| InChIKey | HCGJMEVIRAQANK-ZCOSQGTPSA-N |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|