C29H42O — CID 90707780
2-[(6R,8aR)-6-but-2-enoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-pent-3-enyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 90707780) has the molecular formula C29H42O and a molecular weight of 406.65 g/mol. Its IUPAC name is 2-[(6R,8aR)-6-but-2-enoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-pent-3-enyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[(6R,8aR)-6-but-2-enoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-pent-3-enyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 90707780 |
| Molecular Formula | C29H42O |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | 2-[(6R,8aR)-6-but-2-enoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-pent-3-enyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC=CCCc1ccc2c(c1)CCC(C1CCC3C[C@H](OCC=CC)CC[C@@H]3C1)C2 |
| InChI | InChI=1S/C29H42O/c1-3-5-7-8-22-9-10-24-19-25(12-11-23(24)18-22)26-13-14-28-21-29(30-17-6-4-2)16-15-27(28)20-26/h3-6,9-10,18,25-29H,7-8,11-17,19-21H2,1-2H3/t25?,26?,27-,28?,29-/m1/s1 |
| InChIKey | WBSXEFGFIJZFRH-SIFOPFOPSA-N |
| XLogP | 7.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|