C32H50 — CID 91055196
2-[(6R,8aR)-6-pent-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-heptyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 91055196) has the molecular formula C32H50 and a molecular weight of 434.75 g/mol. Its IUPAC name is 2-[(6R,8aR)-6-pent-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-heptyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[(6R,8aR)-6-pent-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-heptyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 91055196 |
| Molecular Formula | C32H50 |
| Molecular Weight | 434.75 g/mol |
| Exact Mass | 434.39 |
| IUPAC Name | 2-[(6R,8aR)-6-pent-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-heptyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC=CCC[C@@H]1CC[C@@H]2CC(C3CCc4cc(CCCCCCC)ccc4C3)CCC2C1 |
| InChI | InChI=1S/C32H50/c1-3-5-7-8-10-12-26-14-16-30-24-32(20-18-28(30)22-26)31-19-17-27-21-25(11-9-6-4-2)13-15-29(27)23-31/h4,6,14,16,22,25,27,29,31-32H,3,5,7-13,15,17-21,23-24H2,1-2H3/t25-,27?,29-,31?,32?/m1/s1 |
| InChIKey | DFOFDSRWVKDARH-LPJNYQIZSA-N |
| XLogP | 9.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.75 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|