C27H42 — CID 20808618
2-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 20808618) has the molecular formula C27H42 and a molecular weight of 366.63 g/mol. Its IUPAC name is 2-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 20808618 |
| Molecular Formula | C27H42 |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.33 |
| IUPAC Name | 2-[(6R,8aR)-6-hexyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCCCCC[C@@H]1CC[C@@H]2CC(C3CCc4cc(C)ccc4C3)CCC2C1 |
| InChI | InChI=1S/C27H42/c1-3-4-5-6-7-21-9-11-25-19-27(15-13-23(25)17-21)26-14-12-22-16-20(2)8-10-24(22)18-26/h8,10,16,21,23,25-27H,3-7,9,11-15,17-19H2,1-2H3/t21-,23?,25-,26?,27?/m1/s1 |
| InChIKey | VDYKRHBRVLCDFN-NLRHWKDHSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|