C26H34F2O — CID 22383813
6-[(E)-but-2-enoxy]-2-[6-(2,2-difluoroethenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 22383813) has the molecular formula C26H34F2O and a molecular weight of 400.55 g/mol. Its IUPAC name is 6-[(E)-but-2-enoxy]-2-[6-(2,2-difluoroethenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 6-[(E)-but-2-enoxy]-2-[6-(2,2-difluoroethenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 22383813 |
| Molecular Formula | C26H34F2O |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 6-[(E)-but-2-enoxy]-2-[6-(2,2-difluoroethenyl)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/COc1ccc2c(c1)CCC(C1CCC3CC(C=C(F)F)CCC3C1)C2 |
| InChI | InChI=1S/C26H34F2O/c1-2-3-12-29-25-11-10-23-16-22(8-9-24(23)17-25)21-7-6-19-13-18(14-26(27)28)4-5-20(19)15-21/h2-3,10-11,14,17-22H,4-9,12-13,15-16H2,1H3/b3-2+ |
| InChIKey | MTXFOKUJMDUBLJ-NSCUHMNNSA-N |
| XLogP | 7.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|