C27H38 — CID 90779814
2-[(6R,8aR)-6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-prop-1-enyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 90779814) has the molecular formula C27H38 and a molecular weight of 362.60 g/mol. Its IUPAC name is 2-[(6R,8aR)-6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-prop-1-enyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-[(6R,8aR)-6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-prop-1-enyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 90779814 |
| Molecular Formula | C27H38 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | 2-[(6R,8aR)-6-but-3-enyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl]-6-prop-1-enyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=CCC[C@@H]1CC[C@@H]2CC(C3CCc4cc(C=CC)ccc4C3)CCC2C1 |
| InChI | InChI=1S/C27H38/c1-3-5-7-21-9-11-25-19-27(15-13-23(25)17-21)26-14-12-22-16-20(6-4-2)8-10-24(22)18-26/h3-4,6,8,10,16,21,23,25-27H,1,5,7,9,11-15,17-19H2,2H3/t21-,23?,25-,26?,27?/m1/s1 |
| InChIKey | ZNLNZHGPZMTCMR-NLRHWKDHSA-N |
| XLogP | 7.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|