C20H24FN — CID 58840095
1-fluoro-6-[4-[(E)-prop-1-enyl]cyclohexyl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 58840095) has the molecular formula C20H24FN and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-fluoro-6-[4-[(E)-prop-1-enyl]cyclohexyl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | 1-fluoro-6-[4-[(E)-prop-1-enyl]cyclohexyl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 58840095 |
| Molecular Formula | C20H24FN |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-fluoro-6-[4-[(E)-prop-1-enyl]cyclohexyl]-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | C/C=C/C1CCC(C2CCc3c(ccc(C#N)c3F)C2)CC1 |
| InChI | InChI=1S/C20H24FN/c1-2-3-14-4-6-15(7-5-14)16-10-11-19-17(12-16)8-9-18(13-22)20(19)21/h2-3,8-9,14-16H,4-7,10-12H2,1H3/b3-2+ |
| InChIKey | WEQRTSBBFDVGJK-NSCUHMNNSA-N |
| XLogP | 5.18 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|