C28H28F4O — CID 139853585
5-fluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139853585) has the molecular formula C28H28F4O and a molecular weight of 456.52 g/mol. Its IUPAC name is 5-fluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-fluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139853585 |
| Molecular Formula | C28H28F4O |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 5-fluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-6-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/C1CCC(C2CCc3c(ccc(C#Cc4ccc(OC(F)(F)F)cc4)c3F)C2)CC1 |
| InChI | InChI=1S/C28H28F4O/c1-2-3-19-4-9-21(10-5-19)23-14-17-26-24(18-23)13-12-22(27(26)29)11-6-20-7-15-25(16-8-20)33-28(30,31)32/h2-3,7-8,12-13,15-16,19,21,23H,4-5,9-10,14,17-18H2,1H3/b3-2+ |
| InChIKey | XBDXJGXIKORQJU-NSCUHMNNSA-N |
| XLogP | 7.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|