C19H23F3 — CID 139849595
5,6,7-trifluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139849595) has the molecular formula C19H23F3 and a molecular weight of 308.39 g/mol. Its IUPAC name is 5,6,7-trifluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5,6,7-trifluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139849595 |
| Molecular Formula | C19H23F3 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 5,6,7-trifluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/C1CCC(C2CCc3c(cc(F)c(F)c3F)C2)CC1 |
| InChI | InChI=1S/C19H23F3/c1-2-3-12-4-6-13(7-5-12)14-8-9-16-15(10-14)11-17(20)19(22)18(16)21/h2-3,11-14H,4-10H2,1H3/b3-2+ |
| InChIKey | FPIAQCCHEPTMJQ-NSCUHMNNSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|