C26H28F4O — CID 139852688
5-fluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139852688) has the molecular formula C26H28F4O and a molecular weight of 432.50 g/mol. Its IUPAC name is 5-fluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-fluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139852688 |
| Molecular Formula | C26H28F4O |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 5-fluoro-2-[4-[(E)-prop-1-enyl]cyclohexyl]-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C/C=C/C1CCC(C2CCc3c(ccc(-c4ccc(OC(F)(F)F)cc4)c3F)C2)CC1 |
| InChI | InChI=1S/C26H28F4O/c1-2-3-17-4-6-18(7-5-17)20-10-14-24-21(16-20)11-15-23(25(24)27)19-8-12-22(13-9-19)31-26(28,29)30/h2-3,8-9,11-13,15,17-18,20H,4-7,10,14,16H2,1H3/b3-2+ |
| InChIKey | DXABAEIZXAMYQY-NSCUHMNNSA-N |
| XLogP | 7.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|