C25H26F4O — CID 139853275
2-(4-ethenylcyclohexyl)-7-fluoro-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene (PubChem CID 139853275) has the molecular formula C25H26F4O and a molecular weight of 418.47 g/mol. Its IUPAC name is 2-(4-ethenylcyclohexyl)-7-fluoro-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 2-(4-ethenylcyclohexyl)-7-fluoro-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 139853275 |
| Molecular Formula | C25H26F4O |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 2-(4-ethenylcyclohexyl)-7-fluoro-6-[4-(trifluoromethoxy)phenyl]-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=CC1CCC(C2CCc3cc(-c4ccc(OC(F)(F)F)cc4)c(F)cc3C2)CC1 |
| InChI | InChI=1S/C25H26F4O/c1-2-16-3-5-17(6-4-16)19-7-8-20-14-23(24(26)15-21(20)13-19)18-9-11-22(12-10-18)30-25(27,28)29/h2,9-12,14-17,19H,1,3-8,13H2 |
| InChIKey | YQKYYNRZMVBWJP-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|