C27H20F8O — CID 118601271
1-[4-[(4-ethenylcyclohexyl)-difluoromethoxy]-2-fluorophenyl]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene (PubChem CID 118601271) has the molecular formula C27H20F8O and a molecular weight of 512.44 g/mol. Its IUPAC name is 1-[4-[(4-ethenylcyclohexyl)-difluoromethoxy]-2-fluorophenyl]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene.
| Compound Name | 1-[4-[(4-ethenylcyclohexyl)-difluoromethoxy]-2-fluorophenyl]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene |
|---|---|
| PubChem CID | 118601271 |
| Molecular Formula | C27H20F8O |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 1-[4-[(4-ethenylcyclohexyl)-difluoromethoxy]-2-fluorophenyl]-2,3-difluoro-4-(3,4,5-trifluorophenyl)benzene |
| SMILES | C=CC1CCC(C(F)(F)Oc2ccc(-c3ccc(-c4cc(F)c(F)c(F)c4)c(F)c3F)c(F)c2)CC1 |
| InChI | InChI=1S/C27H20F8O/c1-2-14-3-5-16(6-4-14)27(34,35)36-17-7-8-19(21(28)13-17)20-10-9-18(24(31)25(20)32)15-11-22(29)26(33)23(30)12-15/h2,7-14,16H,1,3-6H2 |
| InChIKey | ISXRQXKBCXEUGE-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|